1. Phosphorus Laboratory

  2. Department of Chemistry

  3. Indian Institute of Technology Bombay

Home        Research        Prof. Balakrishna        Group Members        Publications        Teaching        Photo Gallery

 

Publications

1999-1989

  1. (18)New bis(phosphines) derived from N,N'-substituted ethylenediamine derivatives.  Synthesis and transition metal chemistry of X2PN(R)CH2CH2(R)NPX2 (R = CH2Ph or Ph, X = Ph; R = CH2Ph, X2 = O2C6H4).  The crystal and molecular structure of Ph2PN(CH2Ph)CH2CH2(CH2Ph)NPPh2 and cis-[{PtCl2Ph2PN(CH2Ph)CH2CH2(CH2-Ph)NPPh2}]

  2. Maravanji S. Balakrishna, Rita M. Abhyankar and Joel T. Mague

  3. J. Chem. Soc., Dalton Trans., 1999, 1407-1412



  1. (17)Transition Metal Chemistry of Phosphorus based ligands.  Ruthenium(II) Chemistry of Bis(diphosphino)amines, X2PN(R)PX2 (R=H or Ph, X=Ph; R=Ph, X2=O2C6H4)

  2. Maravanji S. Balakrishna, Krishna Ramaswamy and Rita M. Abhyankar

  3. J. Organomet. Chem., 1998, 560, 131-136



  1. (16)Synthesis and Chemistry of the “Metalloligand” [CpRu(h2-dmpm)(h1-dmpm)]Cl.  X-ray Crystal Structures of [CpRu(h2-dmpm)(PPh3)]Cl and [CpRu(h-dmpm)2Pt(PPh3)]PF6.CH2Cl2

  2. Joel T. Mague and Maravanji S. Balakrishna

  3. Polyhedron, 1996, 15, 4259-4268.



  1. (15)Organometallic Chemistry of Diphosphazanes. Rhodium(I) Complexes of RN(PX2)2 [R=C6H5, X=OC6H5, OC6H4Br-p; R=CH3, X=OC6H5)

  2. Maravanji S. Balakrishna and Setharampattu S. Krishnamurthy

  3. Inorg. Chim. Acta, 1995, 230, 245-248



  1. (14)Coordination Chemistry of Diphosphinoamine and Cyclodiphosphazane Ligands

  2. Maravanji S. Balakrishna, V. Sreenivasa Reddy, Setharampattu S. Krishnamurthy, J. F. Nixon and J. C. T. R. Burckett St. Laurent

  3. Coord. Chem. Rev., 1994, 129, 1-90 (Review Article)



  1. (13)Heterodifunctional Ligands Derived from Monooxidized Bis(phosphino)-amines. Synthesis and Transition Metal (Rh(I), Pd(II), Pt(II)) Complexes of Triphosphorus Ligands ((iminophosphoranyl)amino)phosphinic oxides Ph2PN(R)Ph2P:NP(O)(OPh)2 (R = CH3, C2H5). Crystal and Molecular Structures of the Rhodium(I) and Platinum(II) Complexes [(PhO)2(O)PN:PPh2N(C2H5)Ph2PRh(CO)Cl and [(PhO)2(O)PN:PPh2N(C2H5)Ph2PPtCl2

  2. Maravanji S. Balakrishna, Bernard D. Santarsiero, Ronald G. Cavell

  3. Inorg. Chem., 1994, 33, 3079-3084



  1. (12)Heterodifunctional Ligands Derived from Monooxidized Bis(phosphino)amines.  Synthesis and Transition Metal  (Molybdenum(0), Tungsten(0), Rhodium(I), Palladium(II) and Platinum(II)) Complexes of (diphenylphosphino)(diphenylphosphinothioyl)- and (diphenylphosphino)(diphenylphosphinoselenoyl)phenylamine, Ph2PN(Ph)P(E)Ph2 (E = S, Se). Crystal and Molecular Structure of the Pt(II) Complex [Cl2PtPh2PN(Ph)P(S)Ph2].H2O

  2. Maravanji S. Balakrishna, Rita Klein, Stephen Uhlenbrock, A. Alan Pinkerton and Ronald G. Cavell

  3. Inorg. Chem., 1993, 32, 5676-5681



  1. (11)Organometallic Chemistry of Diphosphazanes. Part 7. Platinum(II), Palladium-(0),-(I) and (II) Complexes of RN[P(OPh)2]2 (R = Me or Ph)

  2. Maravanji S. Balakrishna, and Setharampattu S. Krishnamurthy, Ramaswamy Murugavel, Munirathinam Netaji and Irimpan I. Mathews

  3. J. Chem. Soc., Dalton Trans., 1993, 477-482



  1. (10)Heterodifunctional phosphorus-nitrogen compounds: Iminophosphorano-phosphines and their complexes

  2. Ronald G. Cavell, Maravanji S. Balakrishna, Robert W. Reed, Kattesh V. Katti, Paul W. Collins, Vivian Mozol and Ingrid Bartz

  3. Phosphorus, Sulfur Silicon. Relat. Elem., 1993, 76, 9-12



  1. (9)Organometallic Chemistry of Diphosphazanes: IV.  Reactions of the cyclodiphsophazane, cis-[tBuNP(OPh)]2 with M(CO)6 (M = Cr, Mo, W), rhodium(I), palladium(II) and platinum(II) derivatives

  2. Maravanji S. Balakrishna and Setharampattu S. Krishnamurthy

  3. J. Organomet. Chem., 1992, 424, 243-251



  1. (8)Synthetic Spectroscopic and Structural Studies of Transition Metal Complexes of Diphosphazane Ligands

  2. Maravanji S. Balakrishna

  3. J. Ind. Inst. Sci., 1992, 72, 184



  1. (7)Organometallic Derivatives of Diphosphazanes. 2. Seven-coordinated group 6 metal tricarbonyl complexes of diphosphazane ligands.  X-ray crystal structure of [WI2(CO)3{P(OPh)2}2NPh]

  2. Maravanji S. Balakrishna, Setharampattu S. Krishnamurthy and Hattikudur Manohar

  3. Organometallics, 1991, 10, 2522-2525



  1. (6)Organometallic Derivatives of Diphosphazanes. Part 3. The reaction of PhN{P(OPh)2}2 with[Fe(h5-Cp)(CO)2]2. Unusual cleavage of a P-N bond to yield a complex containing P(OPh)2 and PhN(OPh)2 units

  2. Maravanji S. Balakrishna and Setharampattu S. Krishnamurthy

  3. Indian J. Chem., 1991, 30A, 536



  1. (5)Diphosphazanes as Ligands - Links between phosphorus chemistry and organometallic chemistry

  2. Maravanji S. Balakrishna, T. K. Prakasha and Setharamapattu S. Krishnamurthy

  3. Phosphorus, Sulfur Silicon. Relat. Elem., 1990, 49/50, 409-412



  1. (4)Organometallic Derivatives of Diphosphinoamines, X2PN(R)PX2.  Reactions with carbonyl derivatives of group 6 metal and iron pentacarbonyl. The crystal structures of [Mo(CO)4PhN{P(OPh)2}2] and [W(CO)4PrN{P(OPh)2}2]

  2. Maravanji S. Balakrishna, T. K. Prakasha, Setharampattu S. Krishnamurthy, U. Siriwardane and N. S. Hosamane

  3. J. Organomet. Chem., 1990, 390, 203-216



  1. (3)Electronic Structures of RN(PX2)2 (R = CH3 or C6H5; X = Cl, OCH3 or OC6H5) Ligands: An Ultraviolet Photoelectron Spectroscopic Study

  2. T. Pradeep, M. S. Hegde, Maravanji S. Balakrishna and Setharampattu S. Krishnamurthy

  3. J. Electron. Spectrosc. Relat. Phenom., 1990, 53, 119-127



  1. (2)Diphosphazanes as ligands. Symbiosis of phosphorus chemistry and organometallic chemistry

  2. Maravanji S. Balakrishna, T. K. Prakasha and Setharampattu S. Krishnamurthy

  3. Proc. Indian. Nat. Sci. Acad., 1989, 55A, 335



  1. (1)Diphosphazanes as ligands. Symbiosis of phosphorus chemistry and organometallic chemistry

  2. Maravanji S. Balakrishna, T. K. Prakasha and Setharampattu S. Krishnamurthy

  3. Adv. Organomet. Proc. Indo-Sov. Symp. "Organomet. Chem.", 1989, 205

By year:2020 2019 2018 2017 2016 2015 2014 2013 2012 2011 2010 2009 2008 2007 2006 2005 2004 2003 2002 2001 2000 1999-1989