1. Phosphorus Laboratory

  2. Department of Chemistry

  3. Indian Institute of Technology Bombay

Home        Research        Prof. Balakrishna        Group Members        Publications        Teaching        Photo Gallery

 

Publications

2001

  1. (35)Unusual difference in the reactivity of seven-coordinated Mo (II) and W(II) carbonyl complexes of the type [M(CO)3I2(NCCH3)2] with derivatised-dppm, Me3SiN=PPh2CH2PPh2

  2. Maravanji S. Balakrishna, Rashmishree Panda, Srinivasan Priya and Paulose P. George

  3. J. Chem. Res. (S)., 2001, 478-479



  1. (34)New 10-Membered Inorganic Heterocyclic Diphosphanes, PhN{PX}2{(-OC6H2(tBu)2(m-S)((tBu)2C6H2O-)} (X = Cl, F).  Synthesis and Transition Metal Complexes (Molybdenum(0), Ruthenium(II), Palladium(II) and Platinum(II)) of Heterocyclic Diphosphanes. Crystal and Molecular Structures of the Chloro Derivative, PhN{PCl}2{(-OC6H2(tBu)2(m-S)(tBu)2C6H2O-)} and of a Molybdenum(0) Complex of the Fluoro Derivative, [Mo(CO)3{h3-PhN{PF}2{(-OC6H2(tBu)2(m-S)((tBu)2C6H2O-)}-kP,kP,kS}]

  2. Maravanji S. Balakrishna, Rashmishree Panda and Joel T. Mague

  3. Inorg. Chem., 2001, 40, 5620-5625



  1. (33)[PtCl(C6H4CH2O)(PhCH2O)PN(Ph)P-(OCH2Ph)2], the first example of an ortho-Metallated Platinum(II) Complex of a P-N-P Ligand

  2. Maravanji S. Balakrishna

  3. J. Chem. Res. (S). 2001, 270-271



  1. (32)Disulfide and Diselenides of bis(phosphines) derived from N,N'-substituted ethylenediamines.  The crystal and Molecular structure of Ph2P(S)N(Ph)CH2CH2N(Ph)P(S)Ph2

  2. Maravanji S. Balakrishna and Joel T. Mague

  3. Polyhedron, 2001, 20, 2421-2424



  1. (31)Three new spirocyclic palladium(0) complexes containing bis(phosphines) derived from N,N'-substituted ethylenediamines

  2. Maravanji S. Balakrishna

  3. J. Chem. Res. (S). 2001, 206-207



  1. (30)First example of methylene insertion into P(III)-nitrogen bond

  2. Maravanji S. Balakrishna, Srinivasan Priya and Joel T. Mague

  3. Inorg. Chem. Commun., 2001, 4, 437-440



  1. (29)Transition metal chemistry of phosphorus based ligands: Synthesis and transition metal chemistry of N,N'-dimethyl,-bis(diphenylphosphino)ethylene diamine. The crystal and molecular structure of [Re(CO)3Br{Ph2PN(Me)- CH2CH2(Me)NPPh2}]

  2. Maravanji S. Balakrishna and Mrinalini G. Walawalkar

  3. J. Organomet. Chem., 2001, 628, 76-80



  1. (28)New Silylated Iminophosphorano(amino)phosphines, Me3SiN=PPh3N(R)- PPh2 (R=Et, nPr, nBu). Crystal and Molecular Structure of trimethylsilyl-iminophosphorano(propylamino) diphenylphosphine, Me3SiN=PPh2N(nPr)PPh2.  Further oxidative Derivatization with S, Se, and Azides, Titanium(IV) Transmetalation of the Imine, and Syntheses of Rhodium(I), Palladium(II), and Platinum(II) Complexes of These Iminophosphorano(amino)phosphines

  2. Maravanji S. Balakrishna, S. Teipel, A. Alan Pinkerton and Ronald G. Cavell

  3. Inorg. Chem., 2001, 40, 1802-1808



  1. (27)Synthesis and X-ray crystal structure of a novel long chain acyclic phosphazene, N,N'-{dimethyl,bis(diphenylphosphiniminophosphorane)}ethylenediamine, {(PhO)2P(O)N=PN(CH3)CH2}2 obtained via a Staudinger reaction

  2. Maravanji S. Balakrishna and Mrinalini G. Walawalkar

  3. Tetrahedron Lett., 2001, 42, 2733-2734



  1. (26)A Simple and New Method for the Synthesis of 1,5-Benzodiazepine Derivatives on a Solid Surface

  2. Maravanji S. Balakrishna and B. Kaboudin

  3. Tetrahedron Lett., 2001, 42, 1127-1129



  1. (25)Transition Metal Chemistry of Phosphorus Based Ligands: Bis(diaryloxyphosphino)amine Ligands and their Palladium(II) and Platinum(II) derivatives

  2. Maravanji S. Balakrishna

  3. Ind. J. Chem., 2001, 40A, 976-978



  1. (24)Surface-mediated solid phase reactions: Microwave assisted Arbuzov rearrangement on the solid surface

  2. B. Kaboudin and Maravanji S. Balakrishna

  3. Synth. Commun., 2001, 31, 2273-2776

By year:2020 2019 2018 2017 2016 2015 2014 2013 2012 2011 2010 2009 2008 2007 2006 2005 2004 2003 2002 2001 2000 1999-1989