1. Phosphorus Laboratory

  2. Department of Chemistry

  3. Indian Institute of Technology Bombay

Home        Research        Prof. Balakrishna        Group Members        Publications        Teaching        Photo Gallery

 

Publications

2007

  1. (91)Highly Air-Stable Anionic Mononuclear and Neutral Binuclear Palladium(II) Complexes for C-C and C-N Bond-Forming Reactions

  2. Benudhar Punji, Joel T. Mague and Maravanji S. Balakrishna

  3. Inorg. Chem., 2007, 46, 11316-11327



  1. (90)Thioether-Functionalized Ferrocenylbis(phosphonite), Fe{(C5H4)P(-OC10H6(μ-S)C10H6O-)}2: Synthesis, Coordination Behavior and Application in Suzuki Cross-Coupling Reactions

  2. Benudhar Punji, Joel T. Mague and Maravanji S. Balakrishna

  3. Inorg. Chem., 2007, 46, 10268-10275



  1. (89)Cyclodiphosphazane cis-{(o-MeOC6H4O)P(μ-NtBu)}2 as a Bridging Bidentate Ligand: Synthesis, Structures of Heterometallic Complexes, and Halogen Exchange Between Rh-Cl and Cu-X (X = Br, I)

  2. Perumalreddy Chandrasekaran, Joel T. Mague, Ramalingam Venkateswaran and Maravanji S. Balakrishna

  3. Eur. J. Inorg. Chem., 2007, 4988-4997



  1. (88)O-2-Naphthyl diphenyl-thio-phosphinate

  2. Joel T. Mague, Benudhar Punji, Chelladurai Ganesamoorthy and Maravanji S. Balakrishna

  3. Acta Cryst., 2007, E63, o4644



  1. (87)O-2-Naphthyl diphenyl-seleno-phosphinate

  2. Joel T. Mague, Benudhar Punji, Chelladurai Ganesamoorthy and Maravanji S. Balakrishna

  3. Acta Cryst., 2007, E63, o4645



  1. (86)Tetrakis(1-naphthylamino)silane and its tetrahydrofuran trisolvate

  2. Maravanji S. Balakrishna, Tristram Chivers and M. Parvez

  3. Acta Cryst., 2007, C63, o617-o619



  1. (85)9-Sila-9,9-spirobixanthene

  2. Joel T. Mague, Maravanji S. Balakrishna and Ramalingam Venkateswaran

  3. Acta Cryst., 2007, E63, o4429-o4430



  1. (84)Synthesis and Molecular Structure of 1,3-di-tert-butyl-2,4-di(cyclodiphentadienyl)-iron(II)-1,3,2,4-diazadiphosphetidine, [Fe(h5-C5H4)2(PNtBu)2]

  2. Maravanji S. Balakrishna and Joel T. Mague

  3. Organometallics, 2007, 26, 4677-4679



  1. (83)Copper(I) complexes of bis(2-(diphenylphosphino)phenyl)ether: Synthesis, Reactivity and Theoretical Calculations

  2. Ramalingam Venkateswaran, Maravanji S. Balakrishna, Shaikh M. Mobin and Heikki M. Tuononen

  3. Inorg. Chem., 2007, 46, 6335-6341



  1. (82)One-Dimensional Silver(I) Coordination Polymers Containing Cyclodiphosphazane, cis-{(o-MeOC6H4O)P(μ-NtBu)}2

  2. Perumalreddy Chandrasekaran, Joel T. Mague and Maravanji S. Balakrishna

  3. Dalton Trans., 2007, 2957-2962



  1. (81)Methylene insertion into exocyclic P-N bonds of bis(amido)cyclodiphosphazanes, [(tBu(H)NP(μ-NtBu)2]2

  2. Perumalreddy Chandrasekaran, Joel T. Mague and Maravanji S. Balakrishna

  3. Tetrahedron Lett., 2007, 28, 5227-5229



  1. (80)Synthesis and structural studies of RhI, PdI, NiII complexes and one-pot synthesis of binuclear RuII complex [(η6-p-cymene)Ru(μ2-Cl)3Ru{PhN(P(OC6H4OMe-o)2)2}Cl]

  2. Chelladurai Ganesamoorthy, Joel T. Mague and Maravanji S. Balakrishna

  3. J. Organomet. Chem., 2007, 692, 3400-3408



  1. (79)Iminophosphorane-phosphine Ph2PC6H4OC6H4PPh2=NP(O)(OPh)2: Synthesis, reactivity and catalytic activity in Suzuki cross coupling reactions and homogeneous hydrogenation of olefins

  2. Ramalingam Venkateswaran, Maravanji S. Balakrishna and Skaikh M. Mobin

  3. Eur. J. Inorg. Chem., 2007, 1930-1939



  1. (78)Group 11 Metal Complexes of Mesocyclic Thioether Aminophosphonites [-OC10H6(μ-S)C10H6O-]PNC4H8E (E = O, NMe)

  2. Benudhar Punji, Joel T. Mague and Maravanji S. Balakrishna

  3. Eur. J. Inorg. Chem., 2007, 720-731



  1. (77)Two crystalline modifications of 1,1-thio-bis(2-naphthol)

  2. Joel T. Mague, Maravanji S. Balakrishna, Benudhar Punji and Devarajan Suresh

  3. Acta Cryst., 2007, C63, o487-o488



  1. (76)Bis(acetylacetonato)(1,1’methylenebis(4,6-dimethyl-2-phenoxy)titanium(IV)

  2. Maravanji S. Balakrishna, Rashmishree Panda and Joel T. Mague

  3. Acta Cryst., 2007, E63, m1815



  1. (75)Functionalized Cyclodiphosphazanes cis-[tBuNP(OR)]2 (R = C6H4OMe-o, CH2CH2OMe, CH2CH2SMe,CH2CH2NMe2) as neutral 2e, 4e or 8e donor ligands

  2. Maravanji S. Balakrishna, Perumalreddy Chandrasekaran and Ramalingam Venkateswarn

  3. J. Organomet. Chem., 2007, 692, 2642-2648



  1. (74)Chemistry of pnictogen(III)-nitrogen ring systems

  2. Maravanji S. Balakrishna, Dana J. Eisler and Tristram Chivers

  3. Chem. Soc. Rev., 2007, 36, 650-664 (Review Article)



  1. (73)New Bonding Modes for Boraamidinate Ligand in Heavy Group 15 Complexes: Fluxional Behavior of the 1:2 Complexes, LiM[PhB(μ-NtBu)2]2 (M = As, Sb, Bi)

  2. J. Konu, Maravanji S. Balakrishna, Tristram Chivers and T. W. Swaddle

  3. Inorg. Chem., 2007, 46, 2627-2636



  1. (72)Mono- and Di-Substituted Urea Derivatives of Cyclodiphosphazane: [ClP(μ-NtBu)PN(Me)CON(H)Me] and [Me(H)NCON(Me)P(μ-NtBu)]2

  2. Devarajan Suresh, Maravanji S. Balakrishna and Joel T. Mague

  3. Tetrahedron Lett., 2007, 28, 2283-85



  1. (71)Large bite bisphosphite, 2,6-C5H3N{CH2OP(-OC10H6)(μ-S)(C10H6O-)}2: Synthesis, derivatization, transition metal chemistry and application towards hydrogenation of olefins

  2. Benudhar Punji and Maravanji S. Balakrishna

  3. J. Organomet. Chem., 2007, 692, 1683-1689



  1. (70)Ruthenium(II) complexes containing bis(2-(diphenylphosphino)phenyl)ether (DPEphos) and their catalytic activity in hydrogenation reactions

  2. Ramalingam Venkateswaran, Joel T. Mague and Maravanji S. Balakrishna

  3. Inorg. Chem., 2007, 46, 809-817



  1. (69)Di- and Tetranuclear CuI Complexes Containing Phenylaminobis-(phosphonite), PhN{P(OC6H4OMe-o)2}2 and Their Reactivity toward Bipyridyl Ligands

  2. Chelladurai Ganesamoorthy, P. P. George, Joel T. Mague and Maravanji S. Balakrishna

  3. Inorg. Chem., 2007, 46, 848-858

By year:2020 2019 2018 2017 2016 2015 2014 2013 2012 2011 2010 2009 2008 2007 2006 2005 2004 2003 2002 2001 2000 1999-1989